Solving Laplace's equation in cylindrical coordinates (ODE)Laplace's equation in polar coordsQuestions about...

What is brightness?

Can an earth elemental drown/bury its opponent underground using earth glide?

How do I deal with being envious of my own players?

How do you say “my friend is throwing a party, do you wanna come?” in german

What is a term for a function that when called repeatedly, has the same effect as calling once?

Can a Tiny Servant be used as a messenger?

Rationale to prefer local variables over instance variables?

Specific Chinese carabiner QA?

If nine coins are tossed, what is the probability that the number of heads is even?

How to draw tikz paths composed only of horizontal, vertical and diagonal segments?

An Undercover Army

How can friction do no work in case of pure rolling?

Effect of "wrong" driver with slightly long RS-485 stubs

Has Wakanda ever accepted refugees?

Searching for a string that contains the file name

Why won't the strings command stop?

What is the oldest European royal house?

Is divide-by-zero a security vulnerability?

PTIJ: What dummy is the Gemara referring to?

Is there a full canon version of Tyrion's jackass/honeycomb joke?

How do I enter < and > on a broken keyboard?

Can a space-faring robot still function over a billion years?

Why do we see a rainbow of colors reflected off a CD or DVD?

Caulking a corner instead of taping with joint compound?



Solving Laplace's equation in cylindrical coordinates (ODE)


Laplace's equation in polar coordsQuestions about the Laplace's equation in polar coordinatesHow do I solve this differential equation (involving Fourier series)Solving Laplace's equation in a sphere with mixed boundary conditions on the surface.Solving the schrodinger equation in cylindrical coordinatesFinding the solution to Laplace's equation in spherical coordinatesLaplace's equation for boundary conditions.Solving the heat equation with robin boundary conditionsSolving Laplace Equation with two dielectrics in cylindrical coordinatesWhat is the suitable expression to approximate the divergence for cylindrical coordinates













1












$begingroup$


I know this looks like a physics thing, but it's purely the math that I'm stuck on. I'm attempting to write Laplace's equation, $nabla^2V=0$, in cylindrical coordinates for a potential, $V(r,phi,z)$, independent of $z$.
By definition (in cylindrical),
$$
nabla^2V=frac{1}{r}frac{partial}{partial r}left(rfrac{partial V}{partial r}right)+frac{1}{r^2}frac{partial^2 V}{partial phi^2}+frac{partial^2 V}{partial z^2}
$$

in cylindrical coordinates. $frac{partial^2 V}{partial z^2}=0$ and $V(r,phi) = R(r)Phi(phi)$. Plugging in $V(r,phi)$ and using separation of variables:
$$
frac{r}{R}frac{d}{dr}left(rfrac{dR}{dr}right)+frac{1}{Phi}frac{d^2Phi}{dphi^2}=0
$$

Now I have two ordinary differential equations. Using a separation constant $k^2$, I can solve for $Phi(phi)$ easily:
$$
frac{d^2Phi}{dphi^2}=-Phi k^2 quad Rightarrow quad Phi(phi)=Asin(kphi)+Bcos(kphi)
$$

Here's where I'm stuck, solving for $R(r)$
$$
frac{r}{R}frac{d}{dr}left(rfrac{dR}{dr}right)=k^2
$$

I tried applying the product rule and writing it out like this:
$$
rR''+R'-frac{k^2}{r}R=0
$$

but I don't see how to get past this. I'm eventually supposed to end up with something in this form:
$$
V(r, phi)=A_0+B_0ln(r)+sum^infty_{k=1}[r^k(A_kcos(kphi)+B_ksin(kphi))+r^{-k}(C_kcos(kphi)+D_ksin(kphi)]
$$

Some of the constants might be different but this is what I'm going for. A Fourier thing happened somewhere.










share|cite|improve this question











$endgroup$

















    1












    $begingroup$


    I know this looks like a physics thing, but it's purely the math that I'm stuck on. I'm attempting to write Laplace's equation, $nabla^2V=0$, in cylindrical coordinates for a potential, $V(r,phi,z)$, independent of $z$.
    By definition (in cylindrical),
    $$
    nabla^2V=frac{1}{r}frac{partial}{partial r}left(rfrac{partial V}{partial r}right)+frac{1}{r^2}frac{partial^2 V}{partial phi^2}+frac{partial^2 V}{partial z^2}
    $$

    in cylindrical coordinates. $frac{partial^2 V}{partial z^2}=0$ and $V(r,phi) = R(r)Phi(phi)$. Plugging in $V(r,phi)$ and using separation of variables:
    $$
    frac{r}{R}frac{d}{dr}left(rfrac{dR}{dr}right)+frac{1}{Phi}frac{d^2Phi}{dphi^2}=0
    $$

    Now I have two ordinary differential equations. Using a separation constant $k^2$, I can solve for $Phi(phi)$ easily:
    $$
    frac{d^2Phi}{dphi^2}=-Phi k^2 quad Rightarrow quad Phi(phi)=Asin(kphi)+Bcos(kphi)
    $$

    Here's where I'm stuck, solving for $R(r)$
    $$
    frac{r}{R}frac{d}{dr}left(rfrac{dR}{dr}right)=k^2
    $$

    I tried applying the product rule and writing it out like this:
    $$
    rR''+R'-frac{k^2}{r}R=0
    $$

    but I don't see how to get past this. I'm eventually supposed to end up with something in this form:
    $$
    V(r, phi)=A_0+B_0ln(r)+sum^infty_{k=1}[r^k(A_kcos(kphi)+B_ksin(kphi))+r^{-k}(C_kcos(kphi)+D_ksin(kphi)]
    $$

    Some of the constants might be different but this is what I'm going for. A Fourier thing happened somewhere.










    share|cite|improve this question











    $endgroup$















      1












      1








      1





      $begingroup$


      I know this looks like a physics thing, but it's purely the math that I'm stuck on. I'm attempting to write Laplace's equation, $nabla^2V=0$, in cylindrical coordinates for a potential, $V(r,phi,z)$, independent of $z$.
      By definition (in cylindrical),
      $$
      nabla^2V=frac{1}{r}frac{partial}{partial r}left(rfrac{partial V}{partial r}right)+frac{1}{r^2}frac{partial^2 V}{partial phi^2}+frac{partial^2 V}{partial z^2}
      $$

      in cylindrical coordinates. $frac{partial^2 V}{partial z^2}=0$ and $V(r,phi) = R(r)Phi(phi)$. Plugging in $V(r,phi)$ and using separation of variables:
      $$
      frac{r}{R}frac{d}{dr}left(rfrac{dR}{dr}right)+frac{1}{Phi}frac{d^2Phi}{dphi^2}=0
      $$

      Now I have two ordinary differential equations. Using a separation constant $k^2$, I can solve for $Phi(phi)$ easily:
      $$
      frac{d^2Phi}{dphi^2}=-Phi k^2 quad Rightarrow quad Phi(phi)=Asin(kphi)+Bcos(kphi)
      $$

      Here's where I'm stuck, solving for $R(r)$
      $$
      frac{r}{R}frac{d}{dr}left(rfrac{dR}{dr}right)=k^2
      $$

      I tried applying the product rule and writing it out like this:
      $$
      rR''+R'-frac{k^2}{r}R=0
      $$

      but I don't see how to get past this. I'm eventually supposed to end up with something in this form:
      $$
      V(r, phi)=A_0+B_0ln(r)+sum^infty_{k=1}[r^k(A_kcos(kphi)+B_ksin(kphi))+r^{-k}(C_kcos(kphi)+D_ksin(kphi)]
      $$

      Some of the constants might be different but this is what I'm going for. A Fourier thing happened somewhere.










      share|cite|improve this question











      $endgroup$




      I know this looks like a physics thing, but it's purely the math that I'm stuck on. I'm attempting to write Laplace's equation, $nabla^2V=0$, in cylindrical coordinates for a potential, $V(r,phi,z)$, independent of $z$.
      By definition (in cylindrical),
      $$
      nabla^2V=frac{1}{r}frac{partial}{partial r}left(rfrac{partial V}{partial r}right)+frac{1}{r^2}frac{partial^2 V}{partial phi^2}+frac{partial^2 V}{partial z^2}
      $$

      in cylindrical coordinates. $frac{partial^2 V}{partial z^2}=0$ and $V(r,phi) = R(r)Phi(phi)$. Plugging in $V(r,phi)$ and using separation of variables:
      $$
      frac{r}{R}frac{d}{dr}left(rfrac{dR}{dr}right)+frac{1}{Phi}frac{d^2Phi}{dphi^2}=0
      $$

      Now I have two ordinary differential equations. Using a separation constant $k^2$, I can solve for $Phi(phi)$ easily:
      $$
      frac{d^2Phi}{dphi^2}=-Phi k^2 quad Rightarrow quad Phi(phi)=Asin(kphi)+Bcos(kphi)
      $$

      Here's where I'm stuck, solving for $R(r)$
      $$
      frac{r}{R}frac{d}{dr}left(rfrac{dR}{dr}right)=k^2
      $$

      I tried applying the product rule and writing it out like this:
      $$
      rR''+R'-frac{k^2}{r}R=0
      $$

      but I don't see how to get past this. I'm eventually supposed to end up with something in this form:
      $$
      V(r, phi)=A_0+B_0ln(r)+sum^infty_{k=1}[r^k(A_kcos(kphi)+B_ksin(kphi))+r^{-k}(C_kcos(kphi)+D_ksin(kphi)]
      $$

      Some of the constants might be different but this is what I'm going for. A Fourier thing happened somewhere.







      ordinary-differential-equations






      share|cite|improve this question















      share|cite|improve this question













      share|cite|improve this question




      share|cite|improve this question








      edited 1 hour ago







      griffin175

















      asked 6 hours ago









      griffin175griffin175

      84




      84






















          1 Answer
          1






          active

          oldest

          votes


















          0












          $begingroup$

          The radial equation is



          $$ r^2R'' + rR' - k^2R = 0 $$



          If you didn't know, this is called a Cauchy-Euler equation, with well-known solutions of the form $x^n$. Plugging in this form results in the characteristic equation



          $$ m(m-1) + m - k^2 = 0 implies m^2-k^2 = 0 implies m = pm k $$



          If $kne0$, the general solution is



          $$ R_k(r) = A_kr^k + B_kr^{-k} $$



          If $k=0$, we have a double root and the solution has the form



          $$ R_0(r) = A_0 + B_0ln r $$



          You may verify this by directly solving



          $$ r^2R'' + rR' = 0 implies frac{R''}{R'} = -frac{1}{r} implies ln (R') = -ln r + c implies R' = frac{B}{r} implies dots $$






          share|cite|improve this answer









          $endgroup$













          • $begingroup$
            That explains a lot, half the battle is just knowing what it's called. How does $R_k$ get written in terms of sin and cos when combined with $Phi$ in the infinite sum?
            $endgroup$
            – griffin175
            4 hours ago










          • $begingroup$
            If $k=0$, then $Phi$ is constant, otherwise it's just direct multiplication $$ V(r,phi) = A_0 + B_0ln r + sum_{k=1}^infty (A_k r^k + B_kR^{-k})(C_kcos(kphi) + D_ksin(kphi)) $$
            $endgroup$
            – Dylan
            4 hours ago












          • $begingroup$
            I was missing the $r^{-k}$ in my infinite sum that prevented me from seeing this connection. Thanks!
            $endgroup$
            – griffin175
            1 hour ago











          Your Answer





          StackExchange.ifUsing("editor", function () {
          return StackExchange.using("mathjaxEditing", function () {
          StackExchange.MarkdownEditor.creationCallbacks.add(function (editor, postfix) {
          StackExchange.mathjaxEditing.prepareWmdForMathJax(editor, postfix, [["$", "$"], ["\\(","\\)"]]);
          });
          });
          }, "mathjax-editing");

          StackExchange.ready(function() {
          var channelOptions = {
          tags: "".split(" "),
          id: "69"
          };
          initTagRenderer("".split(" "), "".split(" "), channelOptions);

          StackExchange.using("externalEditor", function() {
          // Have to fire editor after snippets, if snippets enabled
          if (StackExchange.settings.snippets.snippetsEnabled) {
          StackExchange.using("snippets", function() {
          createEditor();
          });
          }
          else {
          createEditor();
          }
          });

          function createEditor() {
          StackExchange.prepareEditor({
          heartbeatType: 'answer',
          autoActivateHeartbeat: false,
          convertImagesToLinks: true,
          noModals: true,
          showLowRepImageUploadWarning: true,
          reputationToPostImages: 10,
          bindNavPrevention: true,
          postfix: "",
          imageUploader: {
          brandingHtml: "Powered by u003ca class="icon-imgur-white" href="https://imgur.com/"u003eu003c/au003e",
          contentPolicyHtml: "User contributions licensed under u003ca href="https://creativecommons.org/licenses/by-sa/3.0/"u003ecc by-sa 3.0 with attribution requiredu003c/au003e u003ca href="https://stackoverflow.com/legal/content-policy"u003e(content policy)u003c/au003e",
          allowUrls: true
          },
          noCode: true, onDemand: true,
          discardSelector: ".discard-answer"
          ,immediatelyShowMarkdownHelp:true
          });


          }
          });














          draft saved

          draft discarded


















          StackExchange.ready(
          function () {
          StackExchange.openid.initPostLogin('.new-post-login', 'https%3a%2f%2fmath.stackexchange.com%2fquestions%2f3138592%2fsolving-laplaces-equation-in-cylindrical-coordinates-ode%23new-answer', 'question_page');
          }
          );

          Post as a guest















          Required, but never shown

























          1 Answer
          1






          active

          oldest

          votes








          1 Answer
          1






          active

          oldest

          votes









          active

          oldest

          votes






          active

          oldest

          votes









          0












          $begingroup$

          The radial equation is



          $$ r^2R'' + rR' - k^2R = 0 $$



          If you didn't know, this is called a Cauchy-Euler equation, with well-known solutions of the form $x^n$. Plugging in this form results in the characteristic equation



          $$ m(m-1) + m - k^2 = 0 implies m^2-k^2 = 0 implies m = pm k $$



          If $kne0$, the general solution is



          $$ R_k(r) = A_kr^k + B_kr^{-k} $$



          If $k=0$, we have a double root and the solution has the form



          $$ R_0(r) = A_0 + B_0ln r $$



          You may verify this by directly solving



          $$ r^2R'' + rR' = 0 implies frac{R''}{R'} = -frac{1}{r} implies ln (R') = -ln r + c implies R' = frac{B}{r} implies dots $$






          share|cite|improve this answer









          $endgroup$













          • $begingroup$
            That explains a lot, half the battle is just knowing what it's called. How does $R_k$ get written in terms of sin and cos when combined with $Phi$ in the infinite sum?
            $endgroup$
            – griffin175
            4 hours ago










          • $begingroup$
            If $k=0$, then $Phi$ is constant, otherwise it's just direct multiplication $$ V(r,phi) = A_0 + B_0ln r + sum_{k=1}^infty (A_k r^k + B_kR^{-k})(C_kcos(kphi) + D_ksin(kphi)) $$
            $endgroup$
            – Dylan
            4 hours ago












          • $begingroup$
            I was missing the $r^{-k}$ in my infinite sum that prevented me from seeing this connection. Thanks!
            $endgroup$
            – griffin175
            1 hour ago
















          0












          $begingroup$

          The radial equation is



          $$ r^2R'' + rR' - k^2R = 0 $$



          If you didn't know, this is called a Cauchy-Euler equation, with well-known solutions of the form $x^n$. Plugging in this form results in the characteristic equation



          $$ m(m-1) + m - k^2 = 0 implies m^2-k^2 = 0 implies m = pm k $$



          If $kne0$, the general solution is



          $$ R_k(r) = A_kr^k + B_kr^{-k} $$



          If $k=0$, we have a double root and the solution has the form



          $$ R_0(r) = A_0 + B_0ln r $$



          You may verify this by directly solving



          $$ r^2R'' + rR' = 0 implies frac{R''}{R'} = -frac{1}{r} implies ln (R') = -ln r + c implies R' = frac{B}{r} implies dots $$






          share|cite|improve this answer









          $endgroup$













          • $begingroup$
            That explains a lot, half the battle is just knowing what it's called. How does $R_k$ get written in terms of sin and cos when combined with $Phi$ in the infinite sum?
            $endgroup$
            – griffin175
            4 hours ago










          • $begingroup$
            If $k=0$, then $Phi$ is constant, otherwise it's just direct multiplication $$ V(r,phi) = A_0 + B_0ln r + sum_{k=1}^infty (A_k r^k + B_kR^{-k})(C_kcos(kphi) + D_ksin(kphi)) $$
            $endgroup$
            – Dylan
            4 hours ago












          • $begingroup$
            I was missing the $r^{-k}$ in my infinite sum that prevented me from seeing this connection. Thanks!
            $endgroup$
            – griffin175
            1 hour ago














          0












          0








          0





          $begingroup$

          The radial equation is



          $$ r^2R'' + rR' - k^2R = 0 $$



          If you didn't know, this is called a Cauchy-Euler equation, with well-known solutions of the form $x^n$. Plugging in this form results in the characteristic equation



          $$ m(m-1) + m - k^2 = 0 implies m^2-k^2 = 0 implies m = pm k $$



          If $kne0$, the general solution is



          $$ R_k(r) = A_kr^k + B_kr^{-k} $$



          If $k=0$, we have a double root and the solution has the form



          $$ R_0(r) = A_0 + B_0ln r $$



          You may verify this by directly solving



          $$ r^2R'' + rR' = 0 implies frac{R''}{R'} = -frac{1}{r} implies ln (R') = -ln r + c implies R' = frac{B}{r} implies dots $$






          share|cite|improve this answer









          $endgroup$



          The radial equation is



          $$ r^2R'' + rR' - k^2R = 0 $$



          If you didn't know, this is called a Cauchy-Euler equation, with well-known solutions of the form $x^n$. Plugging in this form results in the characteristic equation



          $$ m(m-1) + m - k^2 = 0 implies m^2-k^2 = 0 implies m = pm k $$



          If $kne0$, the general solution is



          $$ R_k(r) = A_kr^k + B_kr^{-k} $$



          If $k=0$, we have a double root and the solution has the form



          $$ R_0(r) = A_0 + B_0ln r $$



          You may verify this by directly solving



          $$ r^2R'' + rR' = 0 implies frac{R''}{R'} = -frac{1}{r} implies ln (R') = -ln r + c implies R' = frac{B}{r} implies dots $$







          share|cite|improve this answer












          share|cite|improve this answer



          share|cite|improve this answer










          answered 5 hours ago









          DylanDylan

          13.6k31027




          13.6k31027












          • $begingroup$
            That explains a lot, half the battle is just knowing what it's called. How does $R_k$ get written in terms of sin and cos when combined with $Phi$ in the infinite sum?
            $endgroup$
            – griffin175
            4 hours ago










          • $begingroup$
            If $k=0$, then $Phi$ is constant, otherwise it's just direct multiplication $$ V(r,phi) = A_0 + B_0ln r + sum_{k=1}^infty (A_k r^k + B_kR^{-k})(C_kcos(kphi) + D_ksin(kphi)) $$
            $endgroup$
            – Dylan
            4 hours ago












          • $begingroup$
            I was missing the $r^{-k}$ in my infinite sum that prevented me from seeing this connection. Thanks!
            $endgroup$
            – griffin175
            1 hour ago


















          • $begingroup$
            That explains a lot, half the battle is just knowing what it's called. How does $R_k$ get written in terms of sin and cos when combined with $Phi$ in the infinite sum?
            $endgroup$
            – griffin175
            4 hours ago










          • $begingroup$
            If $k=0$, then $Phi$ is constant, otherwise it's just direct multiplication $$ V(r,phi) = A_0 + B_0ln r + sum_{k=1}^infty (A_k r^k + B_kR^{-k})(C_kcos(kphi) + D_ksin(kphi)) $$
            $endgroup$
            – Dylan
            4 hours ago












          • $begingroup$
            I was missing the $r^{-k}$ in my infinite sum that prevented me from seeing this connection. Thanks!
            $endgroup$
            – griffin175
            1 hour ago
















          $begingroup$
          That explains a lot, half the battle is just knowing what it's called. How does $R_k$ get written in terms of sin and cos when combined with $Phi$ in the infinite sum?
          $endgroup$
          – griffin175
          4 hours ago




          $begingroup$
          That explains a lot, half the battle is just knowing what it's called. How does $R_k$ get written in terms of sin and cos when combined with $Phi$ in the infinite sum?
          $endgroup$
          – griffin175
          4 hours ago












          $begingroup$
          If $k=0$, then $Phi$ is constant, otherwise it's just direct multiplication $$ V(r,phi) = A_0 + B_0ln r + sum_{k=1}^infty (A_k r^k + B_kR^{-k})(C_kcos(kphi) + D_ksin(kphi)) $$
          $endgroup$
          – Dylan
          4 hours ago






          $begingroup$
          If $k=0$, then $Phi$ is constant, otherwise it's just direct multiplication $$ V(r,phi) = A_0 + B_0ln r + sum_{k=1}^infty (A_k r^k + B_kR^{-k})(C_kcos(kphi) + D_ksin(kphi)) $$
          $endgroup$
          – Dylan
          4 hours ago














          $begingroup$
          I was missing the $r^{-k}$ in my infinite sum that prevented me from seeing this connection. Thanks!
          $endgroup$
          – griffin175
          1 hour ago




          $begingroup$
          I was missing the $r^{-k}$ in my infinite sum that prevented me from seeing this connection. Thanks!
          $endgroup$
          – griffin175
          1 hour ago


















          draft saved

          draft discarded




















































          Thanks for contributing an answer to Mathematics Stack Exchange!


          • Please be sure to answer the question. Provide details and share your research!

          But avoid



          • Asking for help, clarification, or responding to other answers.

          • Making statements based on opinion; back them up with references or personal experience.


          Use MathJax to format equations. MathJax reference.


          To learn more, see our tips on writing great answers.




          draft saved


          draft discarded














          StackExchange.ready(
          function () {
          StackExchange.openid.initPostLogin('.new-post-login', 'https%3a%2f%2fmath.stackexchange.com%2fquestions%2f3138592%2fsolving-laplaces-equation-in-cylindrical-coordinates-ode%23new-answer', 'question_page');
          }
          );

          Post as a guest















          Required, but never shown





















































          Required, but never shown














          Required, but never shown












          Required, but never shown







          Required, but never shown

































          Required, but never shown














          Required, but never shown












          Required, but never shown







          Required, but never shown







          Popular posts from this blog

          六本木駅

          Integral that is continuous and looks like it converges to a geometric seriesTesting if a geometric series converges by taking limit to infinitySummation of arithmetic-geometric series of higher orderGeometric series with polynomial exponentHow to Recognize a Geometric SeriesShowing an integral equality with series over the integersDiscontinuity of a series of continuous functionsReasons why a Series ConvergesSum of infinite geometric series with two terms in summationUsing geometric series for computing IntegralsLimit of geometric series sum when $r = 1$

          Joseph Lister